CAS 6085-99-0 appears in our catalog under these names: Rizatriptan Impurity 25 Bromide, Rizatriptan Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(4-nitrophenyl)methyl]-1,2,4-triazol-4-ium-4-amine bromide (CAS 6085-99-0) is a chemical compound with the molecular formula C9H10BrN5O2 and a molecular weight of 300.11 g/mol. IUPAC name: 1-[(4-nitrophenyl)methyl]-1,2,4-triazol-4-ium-4-amine bromide. InChIKey: FLEAPQULBLEYNT-UHFFFAOYSA-M.
| Molecular formula | C9H10BrN5O2 |
|---|---|
| Molecular weight | 300.11 g/mol |
| IUPAC name | 1-[(4-nitrophenyl)methyl]-1,2,4-triazol-4-ium-4-amine bromide |
| InChIKey | FLEAPQULBLEYNT-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1CN2C=[N+](C=N2)N)[N+](=O)[O-].[Br-] |
Computed by PubChem (NCBI)