CAS 608510-47-0 appears in our catalog under these names: Pactimibe Sulfate (2:1), Pactimibe sulfate, (7-(2,2-Dimethylpropanamido)-4,6-dimethyl-1-octylindolin-5-yl)acetic acid hemisulfate, Pactimibe sulfate 98%, bis(2-[7-(2,2-dimethylpropanamido)-4,6-dimethyl-1-octyl-2,3-dihydro-1H-indol-5-yl]acetic acid), sulfuric acid. Offered by: TRC, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 50mg, 10mg, 100mg, 10mM (in 1ml dmso), 25mg, 5mg, 1mg, 10 mg.
Bis(2-[7-(2,2-dimethylpropanoylamino)-4,6-dimethyl-1-octyl-2,3-dihydroindol-5-yl]acetic acid);sulfuric acid (CAS 608510-47-0) is a chemical compound with the molecular formula C50H82N4O10S and a molecular weight of 931.3 g/mol. IUPAC name: bis(2-[7-(2,2-dimethylpropanoylamino)-4,6-dimethyl-1-octyl-2,3-dihydroindol-5-yl]acetic acid);sulfuric acid. InChIKey: MKJQESRCXYYHFR-UHFFFAOYSA-N.
| Molecular formula | C50H82N4O10S |
|---|---|
| Molecular weight | 931.3 g/mol |
| IUPAC name | bis(2-[7-(2,2-dimethylpropanoylamino)-4,6-dimethyl-1-octyl-2,3-dihydroindol-5-yl]acetic acid);sulfuric acid |
| InChIKey | MKJQESRCXYYHFR-UHFFFAOYSA-N |
| SMILES | CCCCCCCCN1CCC2=C(C(=C(C(=C21)NC(=O)C(C)(C)C)C)CC(=O)O)C.CCCCCCCCN1CCC2=C(C(=C(C(=C21)NC(=O)C(C)(C)C)C)CC(=O)O)C.OS(=O)(=O)O |
Computed by PubChem (NCBI)