CAS 608512-85-2 appears in our catalog under these names: Fmoc-asp(ofm)-oh, 98%, FMoc-asp(ofm)-oh, 95%, FMOC–ASP(OFM)–OH, Fmoc-L-Asp(OFm)-OH 98%, Fmoc-asp(ofm)-oh, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
(2S)-4-(9H-fluoren-9-ylmethoxy)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid (CAS 608512-85-2) is a chemical compound with the molecular formula C33H27NO6 and a molecular weight of 533.6 g/mol. IUPAC name: (2S)-4-(9H-fluoren-9-ylmethoxy)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid. InChIKey: JBLJMACTOMSWJQ-PMERELPUSA-N.
| Molecular formula | C33H27NO6 |
|---|---|
| Molecular weight | 533.6 g/mol |
| IUPAC name | (2S)-4-(9H-fluoren-9-ylmethoxy)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxobutanoic acid |
| InChIKey | JBLJMACTOMSWJQ-PMERELPUSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)C[C@@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)