CAS 6087-56-5 appears in our catalog under these names: 4–Diazo–N,N–dimethylaniline Chloride Zinc Chloride Hydrate, 4-Diazo-N,N-dimethylaniline Chloride Zinc Chloride, >95.0%(T), 4-(DIMETHYLAMINO)BENZENEDIAZONIUM TRICHLOROZINCATE. Offered by: GLPBio, TCI, Chemat. Available pack sizes: 100g, 25g, 500g.
4-(dimethylamino)benzenediazonium;trichlorozinc(1-) (CAS 6087-56-5) is a chemical compound with the molecular formula C8H10Cl3N3Zn and a molecular weight of 319.9 g/mol. IUPAC name: 4-(dimethylamino)benzenediazonium;trichlorozinc(1-). InChIKey: SIMFPAVQCFHVGM-UHFFFAOYSA-K.
| Molecular formula | C8H10Cl3N3Zn |
|---|---|
| Molecular weight | 319.9 g/mol |
| IUPAC name | 4-(dimethylamino)benzenediazonium;trichlorozinc(1-) |
| InChIKey | SIMFPAVQCFHVGM-UHFFFAOYSA-K |
| SMILES | CN(C)C1=CC=C(C=C1)[N+]#N.Cl[Zn-](Cl)Cl |
Computed by PubChem (NCBI)