CAS 6088-51-3 appears in our catalog under these names: PIR 3·5, 2,2'-Dihydroxy-6,6'-dinaphthyldisulfide, 95%, PIR 3.5/ 97.02% (existing batch purity), 2,2'-Dihydroxy-6,6'-dinaphthyldisulphide, Bis(6-hydroxy-2-naphthyl) Disulfide, >95.0%(HPLC). Offered by: GLPBio, Combi-blocks, TargetMol, Biosynth, TCI. Available pack sizes: 10mg, 50mg, 250mg, 1g, 1mg, 2mg, 5mg, 25mg.
6-[(6-hydroxynaphthalen-2-yl)disulfanyl]naphthalen-2-ol (CAS 6088-51-3) is a chemical compound with the molecular formula C20H14O2S2 and a molecular weight of 350.5 g/mol. IUPAC name: 6-[(6-hydroxynaphthalen-2-yl)disulfanyl]naphthalen-2-ol. InChIKey: AHXGXXJEEHFHDK-UHFFFAOYSA-N.
| Molecular formula | C20H14O2S2 |
|---|---|
| Molecular weight | 350.5 g/mol |
| IUPAC name | 6-[(6-hydroxynaphthalen-2-yl)disulfanyl]naphthalen-2-ol |
| InChIKey | AHXGXXJEEHFHDK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)SSC3=CC4=C(C=C3)C=C(C=C4)O)C=C1O |
Computed by PubChem (NCBI)