CAS 60894-97-5 is the registry number for R-Ipsdienol. Offered by: TRC, Biosynth. Available pack sizes: 100mg.
(4R)-ipsdienol is a meroterpenoid that is (4R)-octa-2,7-dien-4-ol substituted at positions 2 and 6 by methyl and methylidene groups respectively. It has a role as an animal metabolite. It is a secondary alcohol, a meroterpenoid and an olefinic compound.
Source: ChEBI
| Molecular formula | C10H16O |
|---|---|
| Molecular weight | 152.23 g/mol |
| IUPAC name | (4R)-2-methyl-6-methylideneocta-2,7-dien-4-ol |
| InChIKey | NHMKYUHMPXBMFI-JTQLQIEISA-N |
| SMILES | CC(=C[C@@H](CC(=C)C=C)O)C |
Computed by PubChem (NCBI)