CAS 60941-77-7 is the registry number for Exo-8-azabicyclo[3.2.1]octane-3-methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
[(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]methanol (CAS 60941-77-7) is a chemical compound with the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. IUPAC name: [(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]methanol. InChIKey: LONCBIYESAZYOB-IEESLHIDSA-N.
| Molecular formula | C8H15NO |
|---|---|
| Molecular weight | 141.21 g/mol |
| IUPAC name | [(1R,5S)-8-azabicyclo[3.2.1]octan-3-yl]methanol |
| InChIKey | LONCBIYESAZYOB-IEESLHIDSA-N |
| SMILES | C1C[C@H]2CC(C[C@@H]1N2)CO |
Computed by PubChem (NCBI)