CAS 6097-22-9 is the registry number for 3-Nitrophenacyl thiocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[2-(3-nitrophenyl)-2-oxoethyl] thiocyanate (CAS 6097-22-9) is a chemical compound with the molecular formula C9H6N2O3S and a molecular weight of 222.22 g/mol. IUPAC name: [2-(3-nitrophenyl)-2-oxoethyl] thiocyanate. InChIKey: ABKJWLHODKUEJA-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3S |
|---|---|
| Molecular weight | 222.22 g/mol |
| IUPAC name | [2-(3-nitrophenyl)-2-oxoethyl] thiocyanate |
| InChIKey | ABKJWLHODKUEJA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)CSC#N |
Computed by PubChem (NCBI)