CAS 609800-53-5 appears in our catalog under these names: 4-(4-methoxyphenoxy)benzenesulfonic acid, 97%, 4-(4-Methoxyphenoxy)benzenesulfonic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
4-(4-methoxyphenoxy)benzenesulfonic acid (CAS 609800-53-5) is a chemical compound with the molecular formula C13H12O5S and a molecular weight of 280.30 g/mol. IUPAC name: 4-(4-methoxyphenoxy)benzenesulfonic acid. InChIKey: JKKUTAGNBZIAGI-UHFFFAOYSA-N.
| Molecular formula | C13H12O5S |
|---|---|
| Molecular weight | 280.30 g/mol |
| IUPAC name | 4-(4-methoxyphenoxy)benzenesulfonic acid |
| InChIKey | JKKUTAGNBZIAGI-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)OC2=CC=C(C=C2)S(=O)(=O)O |
Computed by PubChem (NCBI)