CAS 61-24-5 appears in our catalog under these names: (6R,7R)-3-(Acetoxymethyl)-7-((R)-5-amino-5-carboxypentanamido)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 97%, 97%, Cefazedone Impurity 2, Cephalosporin Impurity C, Cephalosporin C, 99.12%, Cefazedone Sodium Salt Impurity 2. Offered by: Chemat, Chemat Brand, MedChemExpress. Available pack sizes: 25mg, on request, 50 mg, 25 mg, 10 mg, 5 mg, 100 mg, 10mM/1mL.
Cephalosporin C is a cephalosporin antibiotic carrying a 3-acetoxymethyl substituent and a 6-oxo-N6-L-lysino group at position 7. It has a role as a fungal metabolite. It is functionally related to a cephalosporanic acid. It is a conjugate acid of a cephalosporin C(1-).
Source: ChEBI
| Molecular formula | C16H21N3O8S |
|---|---|
| Molecular weight | 415.4 g/mol |
| IUPAC name | (6R,7R)-3-(acetyloxymethyl)-7-[[(5R)-5-amino-5-carboxypentanoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | HOKIDJSKDBPKTQ-GLXFQSAKSA-N |
| SMILES | CC(=O)OCC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)CCC[C@H](C(=O)O)N)SC1)C(=O)O |
Computed by PubChem (NCBI)