CAS 610-20-8 is the registry number for 2,3-Bis(nitrooxy)butanedioic Acid. Offered by: Chemat Brand. Available pack sizes: on request.
2,3-dinitrooxybutanedioic acid (CAS 610-20-8) is a chemical compound with the molecular formula C4H4N2O10 and a molecular weight of 240.08 g/mol. IUPAC name: 2,3-dinitrooxybutanedioic acid. InChIKey: YIHNLKXIMXGECA-UHFFFAOYSA-N.
| Molecular formula | C4H4N2O10 |
|---|---|
| Molecular weight | 240.08 g/mol |
| IUPAC name | 2,3-dinitrooxybutanedioic acid |
| InChIKey | YIHNLKXIMXGECA-UHFFFAOYSA-N |
| SMILES | C(C(C(=O)O)O[N+](=O)[O-])(C(=O)O)O[N+](=O)[O-] |
Computed by PubChem (NCBI)