Products 610-20-8

CAS 610-20-8 is the registry number for 2,3-Bis(nitrooxy)butanedioic Acid. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,3-dinitrooxybutanedioic acid (CAS 610-20-8) is a chemical compound with the molecular formula C4H4N2O10 and a molecular weight of 240.08 g/mol. IUPAC name: 2,3-dinitrooxybutanedioic acid. InChIKey: YIHNLKXIMXGECA-UHFFFAOYSA-N.

Identity
Molecular formulaC4H4N2O10
Molecular weight240.08 g/mol
IUPAC name2,3-dinitrooxybutanedioic acid
InChIKeyYIHNLKXIMXGECA-UHFFFAOYSA-N
SMILESC(C(C(=O)O)O[N+](=O)[O-])(C(=O)O)O[N+](=O)[O-]

Computed by PubChem (NCBI)