CAS 6100-07-8 is the registry number for 2-Methoxyphenylsulfate Potassium Salt, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g.
Potassium (2-methoxyphenyl) sulfate (CAS 6100-07-8) is a chemical compound with the molecular formula C7H7KO5S and a molecular weight of 242.29 g/mol. IUPAC name: potassium (2-methoxyphenyl) sulfate. InChIKey: UFSSZNFDFJFJBF-UHFFFAOYSA-M.
| Molecular formula | C7H7KO5S |
|---|---|
| Molecular weight | 242.29 g/mol |
| IUPAC name | potassium (2-methoxyphenyl) sulfate |
| InChIKey | UFSSZNFDFJFJBF-UHFFFAOYSA-M |
| SMILES | COC1=CC=CC=C1OS(=O)(=O)[O-].[K+] |
Computed by PubChem (NCBI)