CAS 61001-99-8 is the registry number for Dihydro Fenofibrate. Offered by: TRC. Available pack sizes: 5mg.
Propan-2-yl 2-[4-[(4-chlorophenyl)-hydroxymethyl]phenoxy]-2-methylpropanoate (CAS 61001-99-8) is a chemical compound with the molecular formula C20H23ClO4 and a molecular weight of 362.8 g/mol. IUPAC name: propan-2-yl 2-[4-[(4-chlorophenyl)-hydroxymethyl]phenoxy]-2-methylpropanoate. InChIKey: JUAWSFKKGMCGEL-UHFFFAOYSA-N.
| Molecular formula | C20H23ClO4 |
|---|---|
| Molecular weight | 362.8 g/mol |
| IUPAC name | propan-2-yl 2-[4-[(4-chlorophenyl)-hydroxymethyl]phenoxy]-2-methylpropanoate |
| InChIKey | JUAWSFKKGMCGEL-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C(C)(C)OC1=CC=C(C=C1)C(C2=CC=C(C=C2)Cl)O |
Computed by PubChem (NCBI)