Products 610259-81-9
CAS 610259-81-9 is the registry number for 6-Amino-1-benzyl-5-bromo-3-methyl-1,2,3,4-tetrahydropyrimidine-2,4-dione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
6-amino-1-benzyl-5-bromo-3-methylpyrimidine-2,4-dione (CAS 610259-81-9) is a chemical compound with the molecular formula C12H12BrN3O2 and a molecular weight of 310.15 g/mol. IUPAC name: 6-amino-1-benzyl-5-bromo-3-methylpyrimidine-2,4-dione. InChIKey: WHDJJPOKWBKVKI-UHFFFAOYSA-N.
| Molecular formula | C12H12BrN3O2 |
|---|---|
| Molecular weight | 310.15 g/mol |
| IUPAC name | 6-amino-1-benzyl-5-bromo-3-methylpyrimidine-2,4-dione |
| InChIKey | WHDJJPOKWBKVKI-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=C(N(C1=O)CC2=CC=CC=C2)N)Br |
Computed by PubChem (NCBI)