Products 610279-81-7
CAS 610279-81-7 appears in our catalog under these names: 5-Bromo-2-methylamino-nicotinic acid, 95%, 5-Bromo-2-(methylamino)nicotinic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g, 250mg.
5-bromo-2-(methylamino)pyridine-3-carboxylic acid (CAS 610279-81-7) is a chemical compound with the molecular formula C7H7BrN2O2 and a molecular weight of 231.05 g/mol. IUPAC name: 5-bromo-2-(methylamino)pyridine-3-carboxylic acid. InChIKey: BHDCLIQXRHJKMG-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O2 |
|---|---|
| Molecular weight | 231.05 g/mol |
| IUPAC name | 5-bromo-2-(methylamino)pyridine-3-carboxylic acid |
| InChIKey | BHDCLIQXRHJKMG-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=N1)Br)C(=O)O |
Computed by PubChem (NCBI)