CAS 61039-29-0 is the registry number for (S)-Methyl 2-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl (2S)-2-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanoate;hydrochloride (CAS 61039-29-0) is a chemical compound with the molecular formula C10H12Br2ClNO3 and a molecular weight of 389.47 g/mol. IUPAC name: methyl (2S)-2-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanoate;hydrochloride. InChIKey: WBWBPCPGLKUMGJ-QRPNPIFTSA-N.
| Molecular formula | C10H12Br2ClNO3 |
|---|---|
| Molecular weight | 389.47 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanoate;hydrochloride |
| InChIKey | WBWBPCPGLKUMGJ-QRPNPIFTSA-N |
| SMILES | COC(=O)[C@H](CC1=CC(=C(C(=C1)Br)O)Br)N.Cl |
Computed by PubChem (NCBI)