CAS 6104-48-9 appears in our catalog under these names: Ethynyl(diphenyl)phosphine oxide, 95%, Ethynyl(diphenyl)phosphine Oxide, Ethynyl(diphenyl)phosphine oxide, Ethynyl(diphenyl)phosphine Oxide, >98.0%(GC), Ethynyl(diphenyl)phosphine Oxide 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 250mg, 1g, 200mg, 0,5g, 50mg, 100mg, 5g.
[ethynyl(phenyl)phosphoryl]benzene (CAS 6104-48-9) is a chemical compound with the molecular formula C14H11OP and a molecular weight of 226.21 g/mol. IUPAC name: [ethynyl(phenyl)phosphoryl]benzene. InChIKey: DVERTYATJOQUGS-UHFFFAOYSA-N.
| Molecular formula | C14H11OP |
|---|---|
| Molecular weight | 226.21 g/mol |
| IUPAC name | [ethynyl(phenyl)phosphoryl]benzene |
| InChIKey | DVERTYATJOQUGS-UHFFFAOYSA-N |
| SMILES | C#CP(=O)(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)