Products 61043-58-1
CAS 61043-58-1 appears in our catalog under these names: Z–Ala–Ala–pNA, Z-Ala-Ala-pNA. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 5g, 5000mg, 2000mg, 10000mg.
Benzyl N-[(2S)-1-[[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]carbamate (CAS 61043-58-1) is a chemical compound with the molecular formula C20H22N4O6 and a molecular weight of 414.4 g/mol. IUPAC name: benzyl N-[(2S)-1-[[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]carbamate. InChIKey: TUBKJDFIMPSKNT-KBPBESRZSA-N.
| Molecular formula | C20H22N4O6 |
|---|---|
| Molecular weight | 414.4 g/mol |
| IUPAC name | benzyl N-[(2S)-1-[[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]carbamate |
| InChIKey | TUBKJDFIMPSKNT-KBPBESRZSA-N |
| SMILES | C[C@@H](C(=O)NC1=CC=C(C=C1)[N+](=O)[O-])NC(=O)[C@H](C)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)