CAS 610753-87-2 appears in our catalog under these names: 3-(4-Bromophenyl)-7-[(methylsulfonyl)oxy]-4-oxo-4h-chromene, 95%, 3-(4-Bromophenyl)-4-oxo-4H-chromen-7-yl methanesulfonate, KIN101, 95%, KIN101/ 99.46% (existing batch purity), KIN101. Offered by: Combi-blocks, TRC, AmBeed, TargetMol, GLPBio. Available pack sizes: 250mg, 5g, 1g, 5mg, 10mg, 25mg, 50mg, 100mg.
[3-(4-bromophenyl)-4-oxochromen-7-yl] methanesulfonate (CAS 610753-87-2) is a chemical compound with the molecular formula C16H11BrO5S and a molecular weight of 395.2 g/mol. IUPAC name: [3-(4-bromophenyl)-4-oxochromen-7-yl] methanesulfonate. InChIKey: SJGDYHHAYHRLNC-UHFFFAOYSA-N.
| Molecular formula | C16H11BrO5S |
|---|---|
| Molecular weight | 395.2 g/mol |
| IUPAC name | [3-(4-bromophenyl)-4-oxochromen-7-yl] methanesulfonate |
| InChIKey | SJGDYHHAYHRLNC-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OC1=CC2=C(C=C1)C(=O)C(=CO2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)