CAS 610756-04-2 appears in our catalog under these names: Tricyclopentylphosphine tetrafluoroborate, 98%, Tricyclopentylphosphonium tetrafluoroborate 98%, TRICYCLOPENTYLPHOSPHONIUM TETRAFLUOROBORATE, 95%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
Tricyclopentylphosphanium tetrafluoroborate (CAS 610756-04-2) is a chemical compound with the molecular formula C15H28BF4P and a molecular weight of 326.16 g/mol. IUPAC name: tricyclopentylphosphanium tetrafluoroborate. InChIKey: KTDMVANQORSVPI-UHFFFAOYSA-O.
| Molecular formula | C15H28BF4P |
|---|---|
| Molecular weight | 326.16 g/mol |
| IUPAC name | tricyclopentylphosphanium tetrafluoroborate |
| InChIKey | KTDMVANQORSVPI-UHFFFAOYSA-O |
| SMILES | [B-](F)(F)(F)F.C1CCC(C1)[PH+](C2CCCC2)C3CCCC3 |
Computed by PubChem (NCBI)