CAS 610794-21-3 is the registry number for Dansyl-Azide. Offered by: TRC. Available pack sizes: 500mg.
N-(3-azidopropyl)-5-(dimethylamino)naphthalene-1-sulfonamide (CAS 610794-21-3) is a chemical compound with the molecular formula C15H19N5O2S and a molecular weight of 333.4 g/mol. IUPAC name: N-(3-azidopropyl)-5-(dimethylamino)naphthalene-1-sulfonamide. InChIKey: SBHUGNBDUYEJFA-UHFFFAOYSA-N.
| Molecular formula | C15H19N5O2S |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | N-(3-azidopropyl)-5-(dimethylamino)naphthalene-1-sulfonamide |
| InChIKey | SBHUGNBDUYEJFA-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=CC2=C1C=CC=C2S(=O)(=O)NCCCN=[N+]=[N-] |
Computed by PubChem (NCBI)