CAS 61102-76-9 appears in our catalog under these names: 4–(2,6–Diphenylpyridin–4–yl)aniline, 4-(2,6-diphenylpyridin-4-yl)aniline, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 100mg.
4-(2,6-diphenyl-4-pyridinyl)aniline (CAS 61102-76-9) is a chemical compound with the molecular formula C23H18N2 and a molecular weight of 322.4 g/mol. IUPAC name: 4-(2,6-diphenyl-4-pyridinyl)aniline. InChIKey: TYRDEFILBHSGHA-UHFFFAOYSA-N.
| Molecular formula | C23H18N2 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | 4-(2,6-diphenyl-4-pyridinyl)aniline |
| InChIKey | TYRDEFILBHSGHA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=N2)C3=CC=CC=C3)C4=CC=C(C=C4)N |
Computed by PubChem (NCBI)