CAS 611197-49-0 appears in our catalog under these names: 7-Azaindole n-oxide 3-chlorobenzoate, 95%, 7-Azaindole N-oxide 3-chlorobenzoate, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g.
3-chlorobenzoate;7-hydroxy-1H-pyrrolo[2,3-b]pyridin-7-ium (CAS 611197-49-0) is a chemical compound with the molecular formula C14H11ClN2O3 and a molecular weight of 290.70 g/mol. IUPAC name: 3-chlorobenzoate;7-hydroxy-1H-pyrrolo[2,3-b]pyridin-7-ium. InChIKey: WGCXWHNFXDOYSG-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2O3 |
|---|---|
| Molecular weight | 290.70 g/mol |
| IUPAC name | 3-chlorobenzoate;7-hydroxy-1H-pyrrolo[2,3-b]pyridin-7-ium |
| InChIKey | WGCXWHNFXDOYSG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(=O)[O-].C1=CC2=C(NC=C2)[N+](=C1)O |
Computed by PubChem (NCBI)