CAS 6113-62-8 is the registry number for 2-(4-Chlorophenyl)-1,3,2-benzodioxaborole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
2-(4-chlorophenyl)-1,3,2-benzodioxaborole (CAS 6113-62-8) is a chemical compound with the molecular formula C12H8BClO2 and a molecular weight of 230.45 g/mol. IUPAC name: 2-(4-chlorophenyl)-1,3,2-benzodioxaborole. InChIKey: RDHAMZDLIGWSKH-UHFFFAOYSA-N.
| Molecular formula | C12H8BClO2 |
|---|---|
| Molecular weight | 230.45 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-1,3,2-benzodioxaborole |
| InChIKey | RDHAMZDLIGWSKH-UHFFFAOYSA-N |
| SMILES | B1(OC2=CC=CC=C2O1)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)