CAS 61145-35-5 is the registry number for Cyanomethyl 2,3,4,6-tetra-o-acetyl-beta-d-thioglucopyranoside, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(cyanomethylsulfanyl)oxan-2-yl]methyl acetate (CAS 61145-35-5) is a chemical compound with the molecular formula C16H21NO9S and a molecular weight of 403.4 g/mol. IUPAC name: [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(cyanomethylsulfanyl)oxan-2-yl]methyl acetate. InChIKey: ZNQCXCWNORCJGV-LJIZCISZSA-N.
| Molecular formula | C16H21NO9S |
|---|---|
| Molecular weight | 403.4 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-(cyanomethylsulfanyl)oxan-2-yl]methyl acetate |
| InChIKey | ZNQCXCWNORCJGV-LJIZCISZSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)SCC#N)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)