CAS 61152-62-3 is the registry number for 4-(3,4-Dihydroxyphenyl)butan-2-one. Offered by: MedChemExpress. Available pack sizes: 100 mg, 25 mg, 10 mg, 50 mg, 250 mg.
4-(3,4-dihydroxyphenyl)butan-2-one (CAS 61152-62-3) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 4-(3,4-dihydroxyphenyl)butan-2-one. InChIKey: QIZQZQCADPIVCI-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 4-(3,4-dihydroxyphenyl)butan-2-one |
| InChIKey | QIZQZQCADPIVCI-UHFFFAOYSA-N |
| SMILES | CC(=O)CCC1=CC(=C(C=C1)O)O |
Computed by PubChem (NCBI)