CAS 61167-58-6 appears in our catalog under these names: 2,2'-Methylenebis(6-tert-butyl-4-methylphenol) monoacrylate, 96%, Irganox 3052, Irganox 3052, >95% (HPLC), 2-(tert-Butyl)-6-(3-(tert-butyl)-2-hydroxy-5-methylbenzyl)-4-methylphenyl acrylate, 98% +(stabilized with MEHQ), Irganox 3052. Offered by: Combi-blocks, Chemat Brand, TRC, AmBeed, GLPBio. Available pack sizes: 100g, 5g, 1g, 25g, on request, 500mg, 500g.
[2-tert-butyl-6-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenyl] prop-2-enoate (CAS 61167-58-6) is a chemical compound with the molecular formula C26H34O3 and a molecular weight of 394.5 g/mol. IUPAC name: [2-tert-butyl-6-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenyl] prop-2-enoate. InChIKey: IORUEKDKNHHQAL-UHFFFAOYSA-N.
| Molecular formula | C26H34O3 |
|---|---|
| Molecular weight | 394.5 g/mol |
| IUPAC name | [2-tert-butyl-6-[(3-tert-butyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenyl] prop-2-enoate |
| InChIKey | IORUEKDKNHHQAL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C(C)(C)C)O)CC2=C(C(=CC(=C2)C)C(C)(C)C)OC(=O)C=C |
Computed by PubChem (NCBI)