CAS 61169-66-2 is the registry number for trans-1,2-Bis(chloromethyl)cyclohexane. Offered by: TRC. Available pack sizes: 250mg.
Trans-(1R,2R)-1,2-bis(chloromethyl)cyclohexane (CAS 61169-66-2) is a chemical compound with the molecular formula C8H14Cl2 and a molecular weight of 181.10 g/mol. IUPAC name: trans-(1R,2R)-1,2-bis(chloromethyl)cyclohexane. InChIKey: WJVHONKNAYUVGV-YUMQZZPRSA-N.
| Molecular formula | C8H14Cl2 |
|---|---|
| Molecular weight | 181.10 g/mol |
| IUPAC name | trans-(1R,2R)-1,2-bis(chloromethyl)cyclohexane |
| InChIKey | WJVHONKNAYUVGV-YUMQZZPRSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)CCl)CCl |
Computed by PubChem (NCBI)