CAS 61171-38-8 appears in our catalog under these names: (2,2,6,6-Tetramethylpiperidin-4-yl)methanol hydrochloride, 98%, (2,2,6,6-Tetramethylpiperidin-4-yl)methanol hydrochloride 95%, (2,2,6,6-Tetramethylpiperidin-4-yl)methanol hydrochloride, 98%, 98%, (2,2,6,6-Tetramethyl-4-piperidyl)methanol hydrochloride, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 500mg.
(2,2,6,6-tetramethylpiperidin-4-yl)methanol;hydrochloride (CAS 61171-38-8) is a chemical compound with the molecular formula C10H22ClNO and a molecular weight of 207.74 g/mol. IUPAC name: (2,2,6,6-tetramethylpiperidin-4-yl)methanol;hydrochloride. InChIKey: JODAWCGHVWQBMY-UHFFFAOYSA-N.
| Molecular formula | C10H22ClNO |
|---|---|
| Molecular weight | 207.74 g/mol |
| IUPAC name | (2,2,6,6-tetramethylpiperidin-4-yl)methanol;hydrochloride |
| InChIKey | JODAWCGHVWQBMY-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(N1)(C)C)CO)C.Cl |
Computed by PubChem (NCBI)