CAS 61177-44-4 appears in our catalog under these names: Clavulanate Lithium, Clavulanate lithium/ 99.51% (existing batch purity), Clavulanate lithium, Clavulanate (lithium) (Standard), Clavulanate (lithium), 99.87%. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 1g, 10mg, 25mg, 50mg, 200mg, 5mg.
Lithium (2R,3Z,5R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate (CAS 61177-44-4) is a chemical compound with the molecular formula C8H8LiNO5 and a molecular weight of 205.1 g/mol. IUPAC name: lithium (2R,3Z,5R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate. InChIKey: JMRXTGCDVQLAFM-JSYANWSFSA-M.
| Molecular formula | C8H8LiNO5 |
|---|---|
| Molecular weight | 205.1 g/mol |
| IUPAC name | lithium (2R,3Z,5R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| InChIKey | JMRXTGCDVQLAFM-JSYANWSFSA-M |
| SMILES | [Li+].C1[C@@H]2N(C1=O)[C@H](/C(=C/CO)/O2)C(=O)[O-] |
Computed by PubChem (NCBI)