CAS 6118-33-8 appears in our catalog under these names: Lenvatinib Impurity 38 Chloride, Argatroban Impurity 108. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-sulfobenzenediazonium chloride (CAS 6118-33-8) is a chemical compound with the molecular formula C6H5ClN2O3S and a molecular weight of 220.63 g/mol. IUPAC name: 4-sulfobenzenediazonium chloride. InChIKey: MVAFULKLPSJSGW-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O3S |
|---|---|
| Molecular weight | 220.63 g/mol |
| IUPAC name | 4-sulfobenzenediazonium chloride |
| InChIKey | MVAFULKLPSJSGW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+]#N)S(=O)(=O)O.[Cl-] |
Computed by PubChem (NCBI)