CAS 612-22-6 appears in our catalog under these names: 2-Ethylnitrobenzene, 98%, Lidocaine Impurity 35, 2-Ethylnitrobenzene, >99.0%(GC), 1-ETHYL-2-NITROBENZENE, 96%, 2-Ethylnitrobenzene. Offered by: Combi-blocks, Hubei YoungXin, TCI, Sigma-Aldrich, Fluorochem. Available pack sizes: 100g, 500g, 5g, 1kg, 25g, 10mg, 25mg, 50mg.
1-ethyl-2-nitrobenzene (CAS 612-22-6) is a chemical compound with the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. IUPAC name: 1-ethyl-2-nitrobenzene. InChIKey: PXWYZLWEKCMTEZ-UHFFFAOYSA-N.
| Molecular formula | C8H9NO2 |
|---|---|
| Molecular weight | 151.16 g/mol |
| IUPAC name | 1-ethyl-2-nitrobenzene |
| InChIKey | PXWYZLWEKCMTEZ-UHFFFAOYSA-N |
| SMILES | CCC1=CC=CC=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)