CAS 612-94-2 appears in our catalog under these names: 2–Phenylnaphthalene, 2-Phenylnaphthalene, 95%, 2-Phenylnaphthalene 95%, 2-Phenylnaphthalene, 97%, 2-Phenylnaphthalene, 95-<97%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, Hoffman Fine Chemicals. Available pack sizes: 250mg, 50mg, 1g, 100mg, 5g, 10g, 25g, 50g.
2-phenylnaphthalene (CAS 612-94-2) is a chemical compound with the molecular formula C16H12 and a molecular weight of 204.27 g/mol. IUPAC name: 2-phenylnaphthalene. InChIKey: TURIHPLQSRVWHU-UHFFFAOYSA-N.
| Molecular formula | C16H12 |
|---|---|
| Molecular weight | 204.27 g/mol |
| IUPAC name | 2-phenylnaphthalene |
| InChIKey | TURIHPLQSRVWHU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)