CAS 61203-52-9 is the registry number for 4-Bromo-2,3-dihydroxybenzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-bromo-2,3-dihydroxybenzoic acid (CAS 61203-52-9) is a chemical compound with the molecular formula C7H5BrO4 and a molecular weight of 233.02 g/mol. IUPAC name: 4-bromo-2,3-dihydroxybenzoic acid. InChIKey: DCHSBPLKXWBLIT-UHFFFAOYSA-N.
| Molecular formula | C7H5BrO4 |
|---|---|
| Molecular weight | 233.02 g/mol |
| IUPAC name | 4-bromo-2,3-dihydroxybenzoic acid |
| InChIKey | DCHSBPLKXWBLIT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)O)O)Br |
Computed by PubChem (NCBI)