CAS 612041-76-6 is the registry number for 3-((4-Chloro-3-(trifluoromethyl)phenyl)sulfonamido)benzoic Acid. Offered by: TRC. Available pack sizes: 1g.
3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]benzoic acid (CAS 612041-76-6) is a chemical compound with the molecular formula C14H9ClF3NO4S and a molecular weight of 379.7 g/mol. IUPAC name: 3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]benzoic acid. InChIKey: MYSJZHLEUFMKGZ-UHFFFAOYSA-N.
| Molecular formula | C14H9ClF3NO4S |
|---|---|
| Molecular weight | 379.7 g/mol |
| IUPAC name | 3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylamino]benzoic acid |
| InChIKey | MYSJZHLEUFMKGZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NS(=O)(=O)C2=CC(=C(C=C2)Cl)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)