CAS 612042-35-0 is the registry number for N-(Thiophen-2-ylmethyl)-3-(trifluoromethyl)benzenesulfonamide, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
N-(thiophen-2-ylmethyl)-3-(trifluoromethyl)benzenesulfonamide (CAS 612042-35-0) is a chemical compound with the molecular formula C12H10F3NO2S2 and a molecular weight of 321.3 g/mol. IUPAC name: N-(thiophen-2-ylmethyl)-3-(trifluoromethyl)benzenesulfonamide. InChIKey: BTWNMXUGTLWHFA-UHFFFAOYSA-N.
| Molecular formula | C12H10F3NO2S2 |
|---|---|
| Molecular weight | 321.3 g/mol |
| IUPAC name | N-(thiophen-2-ylmethyl)-3-(trifluoromethyl)benzenesulfonamide |
| InChIKey | BTWNMXUGTLWHFA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)NCC2=CC=CS2)C(F)(F)F |
Computed by PubChem (NCBI)