CAS 612088-55-8 appears in our catalog under these names: DI–TERT–BUTYLPHENYLPHOSPHONIUM TETRAFLUOROBORATE, Di-tert-butylphenylphosphonium tetrafluoroborate 98%, Di-tert-butyl(phenyl)phosphonium tetrafluoroborate, 98%, 98%, Di-tert-butyl(phenyl)phosphonium tetrafluoroborate, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g.
Ditert-butyl(phenyl)phosphanium tetrafluoroborate (CAS 612088-55-8) is a chemical compound with the molecular formula C14H24BF4P and a molecular weight of 310.12 g/mol. IUPAC name: ditert-butyl(phenyl)phosphanium tetrafluoroborate. InChIKey: HRDPEVWZXUWEFR-UHFFFAOYSA-O.
| Molecular formula | C14H24BF4P |
|---|---|
| Molecular weight | 310.12 g/mol |
| IUPAC name | ditert-butyl(phenyl)phosphanium tetrafluoroborate |
| InChIKey | HRDPEVWZXUWEFR-UHFFFAOYSA-O |
| SMILES | [B-](F)(F)(F)F.CC(C)(C)[PH+](C1=CC=CC=C1)C(C)(C)C |
Computed by PubChem (NCBI)