CAS 61219-95-2 appears in our catalog under these names: Flurochloridone Impurity 2, N-Allyl-2,2-dichloro-N-(3-(trifluoromethyl)phenyl)acetamide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
2,2-dichloro-N-prop-2-enyl-N-[3-(trifluoromethyl)phenyl]acetamide (CAS 61219-95-2) is a chemical compound with the molecular formula C12H10Cl2F3NO and a molecular weight of 312.11 g/mol. IUPAC name: 2,2-dichloro-N-prop-2-enyl-N-[3-(trifluoromethyl)phenyl]acetamide. InChIKey: WWINJKYFUBEFBE-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2F3NO |
|---|---|
| Molecular weight | 312.11 g/mol |
| IUPAC name | 2,2-dichloro-N-prop-2-enyl-N-[3-(trifluoromethyl)phenyl]acetamide |
| InChIKey | WWINJKYFUBEFBE-UHFFFAOYSA-N |
| SMILES | C=CCN(C1=CC=CC(=C1)C(F)(F)F)C(=O)C(Cl)Cl |
Computed by PubChem (NCBI)