Products 61247-91-4

CAS 61247-91-4 is the registry number for rel-(1R,3S,5S)-3-methyl-6-oxa-3-phosphabicyclo[3.1.0]hexane 3-oxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(1R,5S)-3-methyl-6-oxa-3lambda5-phosphabicyclo[3.1.0]hexane 3-oxide (CAS 61247-91-4) is a chemical compound with the molecular formula C5H9O2P and a molecular weight of 132.10 g/mol. IUPAC name: (1R,5S)-3-methyl-6-oxa-3lambda5-phosphabicyclo[3.1.0]hexane 3-oxide. InChIKey: CANJRMOZHXYICM-WSUMQKFRSA-N.

Identity
Molecular formulaC5H9O2P
Molecular weight132.10 g/mol
IUPAC name(1R,5S)-3-methyl-6-oxa-3lambda5-phosphabicyclo[3.1.0]hexane 3-oxide
InChIKeyCANJRMOZHXYICM-WSUMQKFRSA-N
SMILESCP1(=O)C[C@@H]2[C@H](C1)O2

Computed by PubChem (NCBI)