CAS 612492-55-4 is the registry number for (S)-4-((tert-Butyldimethylsilyl)oxy)-5,5-dimethylhexan-2-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(4S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylhexan-2-one (CAS 612492-55-4) is a chemical compound with the molecular formula C14H30O2Si and a molecular weight of 258.47 g/mol. IUPAC name: (4S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylhexan-2-one. InChIKey: IQLVSRJKYJOMAY-LBPRGKRZSA-N.
| Molecular formula | C14H30O2Si |
|---|---|
| Molecular weight | 258.47 g/mol |
| IUPAC name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethylhexan-2-one |
| InChIKey | IQLVSRJKYJOMAY-LBPRGKRZSA-N |
| SMILES | CC(=O)C[C@@H](C(C)(C)C)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)