Products 612526-36-0
CAS 612526-36-0 is the registry number for JY-XHe-053. Offered by: MedChemExpress. Available pack sizes: Get quote.
Ethyl 8-ethynyl-6-(2-fluorophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate (CAS 612526-36-0) is a chemical compound with the molecular formula C22H16FN3O2 and a molecular weight of 373.4 g/mol. IUPAC name: ethyl 8-ethynyl-6-(2-fluorophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate. InChIKey: DANIDPUWXPDMNG-UHFFFAOYSA-N.
| Molecular formula | C22H16FN3O2 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | ethyl 8-ethynyl-6-(2-fluorophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate |
| InChIKey | DANIDPUWXPDMNG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2CN=C(C3=C(N2C=N1)C=CC(=C3)C#C)C4=CC=CC=C4F |
Computed by PubChem (NCBI)
Synonyms:
JY-XHe-053, orb1700262