CAS 61259-48-1 is the registry number for 2,3,4,6-Tetra-O-acetyl-D-gluconolactone. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg, 2000mg.
[(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-oxooxan-2-yl]methyl acetate (CAS 61259-48-1) is a chemical compound with the molecular formula C14H18O10 and a molecular weight of 346.29 g/mol. IUPAC name: [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-oxooxan-2-yl]methyl acetate. InChIKey: BWFISYIJSZXAOV-FVCCEPFGSA-N.
| Molecular formula | C14H18O10 |
|---|---|
| Molecular weight | 346.29 g/mol |
| IUPAC name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-oxooxan-2-yl]methyl acetate |
| InChIKey | BWFISYIJSZXAOV-FVCCEPFGSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H](C(=O)O1)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)