CAS 61260-10-4 is the registry number for 4,4'-(Butane-2,2-diyl)bis(2,6-dimethylphenol), 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[2-(4-hydroxy-3,5-dimethylphenyl)butan-2-yl]-2,6-dimethylphenol (CAS 61260-10-4) is a chemical compound with the molecular formula C20H26O2 and a molecular weight of 298.4 g/mol. IUPAC name: 4-[2-(4-hydroxy-3,5-dimethylphenyl)butan-2-yl]-2,6-dimethylphenol. InChIKey: CDQGZJGHIVUWQA-UHFFFAOYSA-N.
| Molecular formula | C20H26O2 |
|---|---|
| Molecular weight | 298.4 g/mol |
| IUPAC name | 4-[2-(4-hydroxy-3,5-dimethylphenyl)butan-2-yl]-2,6-dimethylphenol |
| InChIKey | CDQGZJGHIVUWQA-UHFFFAOYSA-N |
| SMILES | CCC(C)(C1=CC(=C(C(=C1)C)O)C)C2=CC(=C(C(=C2)C)O)C |
Computed by PubChem (NCBI)