CAS 61261-73-2 is the registry number for Palladium(ii) isobutyrate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Bis(2-methylpropanoic acid);palladium (CAS 61261-73-2) is a chemical compound with the molecular formula C8H16O4Pd and a molecular weight of 282.63 g/mol. IUPAC name: bis(2-methylpropanoic acid);palladium. InChIKey: XCVAKIIRUUWTMV-UHFFFAOYSA-N.
| Molecular formula | C8H16O4Pd |
|---|---|
| Molecular weight | 282.63 g/mol |
| IUPAC name | bis(2-methylpropanoic acid);palladium |
| InChIKey | XCVAKIIRUUWTMV-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)O.CC(C)C(=O)O.[Pd] |
Computed by PubChem (NCBI)