Products 61281-37-6
CAS 61281-37-6 appears in our catalog under these names: Schizandrin b, 95%, Schizandrin B, Schisandrin B/ 99.02% (existing batch purity), Schisandrin B, 98.00%, Schizandrin B. Offered by: Combi-blocks, GLPBio, TargetMol, Chemat, Biosynth. Available pack sizes: 250mg, 1g, 20mg, 10mM (in 1ml dmso), 1mg, 5mg, 10mg, 25mg.
3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaene (CAS 61281-37-6) is a chemical compound with the molecular formula C23H28O6 and a molecular weight of 400.5 g/mol. IUPAC name: 3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaene. InChIKey: RTZKSTLPRTWFEV-UHFFFAOYSA-N.
| Molecular formula | C23H28O6 |
|---|---|
| Molecular weight | 400.5 g/mol |
| IUPAC name | 3,4,5,19-tetramethoxy-9,10-dimethyl-15,17-dioxatetracyclo[10.7.0.02,7.014,18]nonadeca-1(19),2,4,6,12,14(18)-hexaene |
| InChIKey | RTZKSTLPRTWFEV-UHFFFAOYSA-N |
| SMILES | CC1CC2=CC3=C(C(=C2C4=C(C(=C(C=C4CC1C)OC)OC)OC)OC)OCO3 |
Computed by PubChem (NCBI)