CAS 612831-24-0 appears in our catalog under these names: 6-(2-(5-Chloro-2-((2,4-difluorobenzyl)oxy)phenyl)cyclopent-1-en-1-yl)picolinic acid, 97%, GW848687X, GW 848687X, GW 848687X. Offered by: Chemat Brand, TargetMol, GLPBio, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, 500ug, 500μg, 500 μg, 1 mg.
6-[2-[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]cyclopenten-1-yl]pyridine-2-carboxylic acid (CAS 612831-24-0) is a chemical compound with the molecular formula C24H18ClF2NO3 and a molecular weight of 441.9 g/mol. IUPAC name: 6-[2-[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]cyclopenten-1-yl]pyridine-2-carboxylic acid. InChIKey: PFODPHDNBFSMOX-UHFFFAOYSA-N.
| Molecular formula | C24H18ClF2NO3 |
|---|---|
| Molecular weight | 441.9 g/mol |
| IUPAC name | 6-[2-[5-chloro-2-[(2,4-difluorophenyl)methoxy]phenyl]cyclopenten-1-yl]pyridine-2-carboxylic acid |
| InChIKey | PFODPHDNBFSMOX-UHFFFAOYSA-N |
| SMILES | C1CC(=C(C1)C2=C(C=CC(=C2)Cl)OCC3=C(C=C(C=C3)F)F)C4=NC(=CC=C4)C(=O)O |
Computed by PubChem (NCBI)