CAS 612833-66-6 appears in our catalog under these names: 1-(Benzyloxy)-4-bromo-2-iodobenzene, 95%, 95%, 1-Benzyloxy-4-bromo-2-iodo-benzene, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-bromo-2-iodo-1-phenylmethoxybenzene (CAS 612833-66-6) is a chemical compound with the molecular formula C13H10BrIO and a molecular weight of 389.03 g/mol. IUPAC name: 4-bromo-2-iodo-1-phenylmethoxybenzene. InChIKey: MODLWAAGRUEXRL-UHFFFAOYSA-N.
| Molecular formula | C13H10BrIO |
|---|---|
| Molecular weight | 389.03 g/mol |
| IUPAC name | 4-bromo-2-iodo-1-phenylmethoxybenzene |
| InChIKey | MODLWAAGRUEXRL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)Br)I |
Computed by PubChem (NCBI)