Products 61285-69-6
CAS 61285-69-6 is the registry number for Tetradecane Related Compound 7. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-2,6,8-trimethylnon-5-en-4-one (CAS 61285-69-6) is a chemical compound with the molecular formula C12H22O and a molecular weight of 182.30 g/mol. IUPAC name: (E)-2,6,8-trimethylnon-5-en-4-one. InChIKey: LQDBBNKHEUWCGE-DHZHZOJOSA-N.
| Molecular formula | C12H22O |
|---|---|
| Molecular weight | 182.30 g/mol |
| IUPAC name | (E)-2,6,8-trimethylnon-5-en-4-one |
| InChIKey | LQDBBNKHEUWCGE-DHZHZOJOSA-N |
| SMILES | CC(C)C/C(=C/C(=O)CC(C)C)/C |
Computed by PubChem (NCBI)