CAS 61298-37-1 is the registry number for rac-(5R,6S)-5-Amino-6-phenylpiperidin-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(5R,6S)-5-amino-6-phenylpiperidin-2-one (CAS 61298-37-1) is a chemical compound with the molecular formula C11H14N2O and a molecular weight of 190.24 g/mol. IUPAC name: (5R,6S)-5-amino-6-phenylpiperidin-2-one. InChIKey: BKFJIBKJLGSOGY-KOLCDFICSA-N.
| Molecular formula | C11H14N2O |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | (5R,6S)-5-amino-6-phenylpiperidin-2-one |
| InChIKey | BKFJIBKJLGSOGY-KOLCDFICSA-N |
| SMILES | C1CC(=O)N[C@H]([C@@H]1N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)