CAS 613-53-6 appears in our catalog under these names: Alpha,alpha,alpha-tribromoquinaldine, 95%, 2-Tribromomethylquinoline, >98.0%(HPLC)(T), 2-(Tribromomethyl)quinoline. Offered by: Combi-blocks, TCI, Chemat. Available pack sizes: 1g, 5g.
2-(tribromomethyl)quinoline (CAS 613-53-6) is a chemical compound with the molecular formula C10H6Br3N and a molecular weight of 379.87 g/mol. IUPAC name: 2-(tribromomethyl)quinoline. InChIKey: UDYYQHILRSDDMP-UHFFFAOYSA-N.
| Molecular formula | C10H6Br3N |
|---|---|
| Molecular weight | 379.87 g/mol |
| IUPAC name | 2-(tribromomethyl)quinoline |
| InChIKey | UDYYQHILRSDDMP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)C(Br)(Br)Br |
Computed by PubChem (NCBI)